C20H12N6O4S4 — CID 25189958
[2,6-bis(dicyanomethylidene)-8-(dimethylcarbamoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] N,N-dimethylcarbamate (PubChem CID 25189958) has the molecular formula C20H12N6O4S4 and a molecular weight of 528.62 g/mol. Its IUPAC name is [2,6-bis(dicyanomethylidene)-8-(dimethylcarbamoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] N,N-dimethylcarbamate.
| Compound Name | [2,6-bis(dicyanomethylidene)-8-(dimethylcarbamoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 25189958 |
| Molecular Formula | C20H12N6O4S4 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | [2,6-bis(dicyanomethylidene)-8-(dimethylcarbamoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1c2c(c(OC(=O)N(C)C)c3c1SC(=C(C#N)C#N)S3)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C20H12N6O4S4/c1-25(2)19(27)29-11-13-15(33-17(31-13)9(5-21)6-22)12(30-20(28)26(3)4)16-14(11)32-18(34-16)10(7-23)8-24/h1-4H3 |
| InChIKey | ZPVKSOMLPKHOGB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 154.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|