C34H40N2O8S4 — CID 25189961
[2,6-bis(1-cyano-2-ethoxy-2-oxoethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate (PubChem CID 25189961) has the molecular formula C34H40N2O8S4 and a molecular weight of 732.97 g/mol. Its IUPAC name is [2,6-bis(1-cyano-2-ethoxy-2-oxoethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate.
| Compound Name | [2,6-bis(1-cyano-2-ethoxy-2-oxoethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 25189961 |
| Molecular Formula | C34H40N2O8S4 |
| Molecular Weight | 732.97 g/mol |
| Exact Mass | 732.17 |
| IUPAC Name | [2,6-bis(1-cyano-2-ethoxy-2-oxoethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1c2c(c(OC(=O)C(CC)CCCC)c3c1SC(=C(C#N)C(=O)OCC)S3)SC(=C(C#N)C(=O)OCC)S2 |
| InChI | InChI=1S/C34H40N2O8S4/c1-7-13-15-19(9-3)29(37)43-23-25-27(47-33(45-25)21(17-35)31(39)41-11-5)24(44-30(38)20(10-4)16-14-8-2)28-26(23)46-34(48-28)22(18-36)32(40)42-12-6/h19-20H,7-16H2,1-6H3/b33-21-,34-22+ |
| InChIKey | RIVAPBPHSFEJIG-NRYMNODQSA-N |
| XLogP | 8.92 |
| TPSA | 152.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.97 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|