C22H16N2O8S4 — CID 25189962
ethyl 2-cyano-2-[4,8-diacetyloxy-2-(1-cyano-2-ethoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate (PubChem CID 25189962) has the molecular formula C22H16N2O8S4 and a molecular weight of 564.64 g/mol. Its IUPAC name is ethyl 2-cyano-2-[4,8-diacetyloxy-2-(1-cyano-2-ethoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate.
| Compound Name | ethyl 2-cyano-2-[4,8-diacetyloxy-2-(1-cyano-2-ethoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
|---|---|
| PubChem CID | 25189962 |
| Molecular Formula | C22H16N2O8S4 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 563.98 |
| IUPAC Name | ethyl 2-cyano-2-[4,8-diacetyloxy-2-(1-cyano-2-ethoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
| SMILES | CCOC(=O)C(C#N)=C1Sc2c(OC(C)=O)c3c(c(OC(C)=O)c2S1)SC(=C(C#N)C(=O)OCC)S3 |
| InChI | InChI=1S/C22H16N2O8S4/c1-5-29-19(27)11(7-23)21-33-15-13(31-9(3)25)17-18(14(16(15)34-21)32-10(4)26)36-22(35-17)12(8-24)20(28)30-6-2/h5-6H2,1-4H3/b21-11-,22-12+ |
| InChIKey | IUDOLLSTNVOCPI-ZCJKAFFOSA-N |
| XLogP | 4.53 |
| TPSA | 152.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|