C20H10N4O6S4 — CID 25190074
3-[[8-(2-carboxyethoxy)-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]oxy]propanoic acid (PubChem CID 25190074) has the molecular formula C20H10N4O6S4 and a molecular weight of 530.59 g/mol. Its IUPAC name is 3-[[8-(2-carboxyethoxy)-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]oxy]propanoic acid.
| Compound Name | 3-[[8-(2-carboxyethoxy)-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 25190074 |
| Molecular Formula | C20H10N4O6S4 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 529.95 |
| IUPAC Name | 3-[[8-(2-carboxyethoxy)-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl]oxy]propanoic acid |
| SMILES | N#CC(C#N)=C1Sc2c(OCCC(=O)O)c3c(c(OCCC(=O)O)c2S1)SC(=C(C#N)C#N)S3 |
| InChI | InChI=1S/C20H10N4O6S4/c21-5-9(6-22)19-31-15-13(29-3-1-11(25)26)16-18(34-20(32-16)10(7-23)8-24)14(17(15)33-19)30-4-2-12(27)28/h1-4H2,(H,25,26)(H,27,28) |
| InChIKey | CTGCKVRNCOMGCC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 188.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|