C29H27N9S — CID 25190217
2-[5-[1-[[4-(2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)phenyl]methyl]piperidin-4-yl]-1H-1,2,4-triazol-3-yl]-1,3-thiazole (PubChem CID 25190217) has the molecular formula C29H27N9S and a molecular weight of 533.67 g/mol. Its IUPAC name is 2-[5-[1-[[4-(2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)phenyl]methyl]piperidin-4-yl]-1H-1,2,4-triazol-3-yl]-1,3-thiazole.
| Compound Name | 2-[5-[1-[[4-(2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)phenyl]methyl]piperidin-4-yl]-1H-1,2,4-triazol-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 25190217 |
| Molecular Formula | C29H27N9S |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 2-[5-[1-[[4-(2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)phenyl]methyl]piperidin-4-yl]-1H-1,2,4-triazol-3-yl]-1,3-thiazole |
| SMILES | Cc1nc2nc(-c3ccc(CN4CCC(c5nc(-c6nccs6)n[nH]5)CC4)cc3)c(-c3ccccc3)cn2n1 |
| InChI | InChI=1S/C29H27N9S/c1-19-31-29-32-25(24(18-38(29)36-19)21-5-3-2-4-6-21)22-9-7-20(8-10-22)17-37-14-11-23(12-15-37)26-33-27(35-34-26)28-30-13-16-39-28/h2-10,13,16,18,23H,11-12,14-15,17H2,1H3,(H,33,34,35) |
| InChIKey | WELWRBPANJAEMX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |