C18H14F3N3O — CID 25190327
N-(diaminomethylidene)-8-(2,4,6-trifluorophenyl)-5,6-dihydronaphthalene-2-carboxamide (PubChem CID 25190327) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is N-(diaminomethylidene)-8-(2,4,6-trifluorophenyl)-5,6-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-8-(2,4,6-trifluorophenyl)-5,6-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 25190327 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-(diaminomethylidene)-8-(2,4,6-trifluorophenyl)-5,6-dihydronaphthalene-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(c1)C(c1c(F)cc(F)cc1F)=CCC2 |
| InChI | InChI=1S/C18H14F3N3O/c19-11-7-14(20)16(15(21)8-11)12-3-1-2-9-4-5-10(6-13(9)12)17(25)24-18(22)23/h3-8H,1-2H2,(H4,22,23,24,25) |
| InChIKey | IOWBFFBMIWKIOF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|