C18H15F2N3O — CID 25190379
N-(diaminomethylidene)-8-(2,6-difluorophenyl)-5,6-dihydronaphthalene-2-carboxamide (PubChem CID 25190379) has the molecular formula C18H15F2N3O and a molecular weight of 327.33 g/mol. Its IUPAC name is N-(diaminomethylidene)-8-(2,6-difluorophenyl)-5,6-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-8-(2,6-difluorophenyl)-5,6-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 25190379 |
| Molecular Formula | C18H15F2N3O |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(diaminomethylidene)-8-(2,6-difluorophenyl)-5,6-dihydronaphthalene-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(c1)C(c1c(F)cccc1F)=CCC2 |
| InChI | InChI=1S/C18H15F2N3O/c19-14-5-2-6-15(20)16(14)12-4-1-3-10-7-8-11(9-13(10)12)17(24)23-18(21)22/h2,4-9H,1,3H2,(H4,21,22,23,24) |
| InChIKey | JMKDWCVQWSQKHW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|