C18H12N2O3 — CID 25190446
6-(2-hydroxyphenyl)-4-(4-hydroxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 25190446) has the molecular formula C18H12N2O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)-4-(4-hydroxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(2-hydroxyphenyl)-4-(4-hydroxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 25190446 |
| Molecular Formula | C18H12N2O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 6-(2-hydroxyphenyl)-4-(4-hydroxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(O)cc2)cc(-c2ccccc2O)[nH]c1=O |
| InChI | InChI=1S/C18H12N2O3/c19-10-15-14(11-5-7-12(21)8-6-11)9-16(20-18(15)23)13-3-1-2-4-17(13)22/h1-9,21-22H,(H,20,23) |
| InChIKey | ZPDMQXNFMLCPDW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |