C16H15NO5 — CID 25190452
ethyl 1-methyl-2,5-dioxo-3,10b-dihydrochromeno[4,3-b]pyridine-4-carboxylate (PubChem CID 25190452) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is ethyl 1-methyl-2,5-dioxo-3,10b-dihydrochromeno[4,3-b]pyridine-4-carboxylate.
| Compound Name | ethyl 1-methyl-2,5-dioxo-3,10b-dihydrochromeno[4,3-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 25190452 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | ethyl 1-methyl-2,5-dioxo-3,10b-dihydrochromeno[4,3-b]pyridine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2C(=O)Oc3ccccc3C2N(C)C(=O)C1 |
| InChI | InChI=1S/C16H15NO5/c1-3-21-15(19)10-8-12(18)17(2)14-9-6-4-5-7-11(9)22-16(20)13(10)14/h4-7,14H,3,8H2,1-2H3 |
| InChIKey | YQUCNCKNGPDWCY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|