methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate

C24H20N2O3 — CID 25190466

IUPACmethyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate
SMILESCOC(=O)COc1cccc(-n2cnc(-c3ccccc3)c2-c2ccccc2)c1
InChIInChI=1S/C24H20N2O3/c1-28-22(27)16-29-21-14-8-13-20(15-21)26-17-25-23(18-9-4-2-5-10-18)24(26)19-11-6-3-7-12-19/h2-15,17H,16H2,1H3
InChIKeyRYGSHULDICKKAP-UHFFFAOYSA-N
MW384.44 g/mol
LogP4.76
Rot. Bonds6

About methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate

methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate (PubChem CID 25190466) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate.

Molecular Properties

Compound Namemethyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate
PubChem CID25190466
Molecular FormulaC24H20N2O3
Molecular Weight384.44 g/mol
Exact Mass384.15
IUPAC Namemethyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate
SMILESCOC(=O)COc1cccc(-n2cnc(-c3ccccc3)c2-c2ccccc2)c1
InChIInChI=1S/C24H20N2O3/c1-28-22(27)16-29-21-14-8-13-20(15-21)26-17-25-23(18-9-4-2-5-10-18)24(26)19-11-6-3-7-12-19/h2-15,17H,16H2,1H3
InChIKeyRYGSHULDICKKAP-UHFFFAOYSA-N
XLogP4.76
TPSA53.35 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms29
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500384.44
LogP ≤ 54.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate?
The IUPAC name of methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate (CID 25190466) is methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate.
What is the SMILES notation for methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate?
The canonical SMILES for methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate is COC(=O)COc1cccc(-n2cnc(-c3ccccc3)c2-c2ccccc2)c1.
What is the InChIKey of methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate?
The InChIKey is RYGSHULDICKKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O3/c1-28-22(27)16-29-21-14-8-13-20(15-21)26-17-25-23(18-9-4-2-5-10-18)24(26)19-11-6-3-7-12-19/h2-15,17H,16H2,1H3.
What are the key properties of methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate?
methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate has a molecular weight of 384.44 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(4,5-diphenylimidazol-1-yl)phenoxy]acetate is sourced from PubChem (CID 25190466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).