About ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate
ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate (PubChem CID 25190472) has the molecular formula C27H34N2O2
and a molecular weight of 418.58 g/mol. Its IUPAC name is ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate.
Molecular Properties
| Compound Name | ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate |
| PubChem CID | 25190472 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate |
| SMILES | CCOC(=O)C(CC)CCCCCn1c(C)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H34N2O2/c1-4-22(27(30)31-5-2)15-13-8-14-20-29-21(3)28-25(23-16-9-6-10-17-23)26(29)24-18-11-7-12-19-24/h6-7,9-12,16-19,22H,4-5,8,13-15,20H2,1-3H3 |
| InChIKey | UHTNRRRVPYSFKW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate?
The IUPAC name of ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate (CID 25190472) is ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate.
What is the SMILES notation for ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate?
The canonical SMILES for ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate is CCOC(=O)C(CC)CCCCCn1c(C)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate?
The InChIKey is UHTNRRRVPYSFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34N2O2/c1-4-22(27(30)31-5-2)15-13-8-14-20-29-21(3)28-25(23-16-9-6-10-17-23)26(29)24-18-11-7-12-19-24/h6-7,9-12,16-19,22H,4-5,8,13-15,20H2,1-3H3.
What are the key properties of ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate?
ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate has a molecular weight of 418.58 g/mol, XLogP of 6.68, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethyl-7-(2-methyl-4,5-diphenylimidazol-1-yl)heptanoate is sourced from PubChem (CID 25190472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).