About ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate
ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate (PubChem CID 25190480) has the molecular formula C25H28F2N2O2
and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate |
| PubChem CID | 25190480 |
| Molecular Formula | C25H28F2N2O2 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCn1c(C)nc(-c2ccc(F)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H28F2N2O2/c1-3-31-23(30)8-6-4-5-7-17-29-18(2)28-24(19-9-13-21(26)14-10-19)25(29)20-11-15-22(27)16-12-20/h9-16H,3-8,17H2,1-2H3 |
| InChIKey | BZNKOJZOSNRABX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate?
The IUPAC name of ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate (CID 25190480) is ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate.
What is the SMILES notation for ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate?
The canonical SMILES for ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate is CCOC(=O)CCCCCCn1c(C)nc(-c2ccc(F)cc2)c1-c1ccc(F)cc1.
What is the InChIKey of ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate?
The InChIKey is BZNKOJZOSNRABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28F2N2O2/c1-3-31-23(30)8-6-4-5-7-17-29-18(2)28-24(19-9-13-21(26)14-10-19)25(29)20-11-15-22(27)16-12-20/h9-16H,3-8,17H2,1-2H3.
What are the key properties of ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate?
ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate has a molecular weight of 426.51 g/mol, XLogP of 6.32, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]heptanoate is sourced from PubChem (CID 25190480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).