C30H34Cl2N4O — CID 25190586
8-[bis(2-chlorophenyl)methyl]-3-[2-(ethylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 25190586) has the molecular formula C30H34Cl2N4O and a molecular weight of 537.54 g/mol. Its IUPAC name is 8-[bis(2-chlorophenyl)methyl]-3-[2-(ethylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[bis(2-chlorophenyl)methyl]-3-[2-(ethylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 25190586 |
| Molecular Formula | C30H34Cl2N4O |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 8-[bis(2-chlorophenyl)methyl]-3-[2-(ethylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCNCCN1CN(c2ccccc2)C2(CCN(C(c3ccccc3Cl)c3ccccc3Cl)CC2)C1=O |
| InChI | InChI=1S/C30H34Cl2N4O/c1-2-33-18-21-35-22-36(23-10-4-3-5-11-23)30(29(35)37)16-19-34(20-17-30)28(24-12-6-8-14-26(24)31)25-13-7-9-15-27(25)32/h3-15,28,33H,2,16-22H2,1H3 |
| InChIKey | SZEZVGVHEGRAQG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|