C32H38Cl2N4O — CID 25190594
8-[bis(2-chlorophenyl)methyl]-3-[2-(2-methylpropylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 25190594) has the molecular formula C32H38Cl2N4O and a molecular weight of 565.59 g/mol. Its IUPAC name is 8-[bis(2-chlorophenyl)methyl]-3-[2-(2-methylpropylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[bis(2-chlorophenyl)methyl]-3-[2-(2-methylpropylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 25190594 |
| Molecular Formula | C32H38Cl2N4O |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 8-[bis(2-chlorophenyl)methyl]-3-[2-(2-methylpropylamino)ethyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC(C)CNCCN1CN(c2ccccc2)C2(CCN(C(c3ccccc3Cl)c3ccccc3Cl)CC2)C1=O |
| InChI | InChI=1S/C32H38Cl2N4O/c1-24(2)22-35-18-21-37-23-38(25-10-4-3-5-11-25)32(31(37)39)16-19-36(20-17-32)30(26-12-6-8-14-28(26)33)27-13-7-9-15-29(27)34/h3-15,24,30,35H,16-23H2,1-2H3 |
| InChIKey | IRBLDGMIGSNXLP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|