C30H40N4O — CID 25190616
8-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-1-phenyl-3-[2-(prop-2-enylamino)ethyl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 25190616) has the molecular formula C30H40N4O and a molecular weight of 472.68 g/mol. Its IUPAC name is 8-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-1-phenyl-3-[2-(prop-2-enylamino)ethyl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-1-phenyl-3-[2-(prop-2-enylamino)ethyl]-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 25190616 |
| Molecular Formula | C30H40N4O |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 8-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-1-phenyl-3-[2-(prop-2-enylamino)ethyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | C=CCNCCN1CN(c2ccccc2)C2(CCN(C3CCC(C)(C)c4ccccc43)CC2)C1=O |
| InChI | InChI=1S/C30H40N4O/c1-4-18-31-19-22-33-23-34(24-10-6-5-7-11-24)30(28(33)35)16-20-32(21-17-30)27-14-15-29(2,3)26-13-9-8-12-25(26)27/h4-13,27,31H,1,14-23H2,2-3H3 |
| InChIKey | NJGHPWBZRUJKIQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|