C37H55N5O7 — CID 25190640
tert-butyl N-[(3S,14S,17S,18R,20S)-14-[2-[[2-(benzylamino)-2-oxoethyl]amino]-2-oxoacetyl]-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate (PubChem CID 25190640) has the molecular formula C37H55N5O7 and a molecular weight of 681.88 g/mol. Its IUPAC name is tert-butyl N-[(3S,14S,17S,18R,20S)-14-[2-[[2-(benzylamino)-2-oxoethyl]amino]-2-oxoacetyl]-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,14S,17S,18R,20S)-14-[2-[[2-(benzylamino)-2-oxoethyl]amino]-2-oxoacetyl]-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
|---|---|
| PubChem CID | 25190640 |
| Molecular Formula | C37H55N5O7 |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 681.41 |
| IUPAC Name | tert-butyl N-[(3S,14S,17S,18R,20S)-14-[2-[[2-(benzylamino)-2-oxoethyl]amino]-2-oxoacetyl]-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCCCCCC[C@@H](C(=O)C(=O)NCC(=O)NCc2ccccc2)NC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C37H55N5O7/c1-36(2,3)49-35(48)41-27-20-16-11-9-7-6-8-10-15-19-26(40-32(45)30-29-25(37(29,4)5)23-42(30)34(27)47)31(44)33(46)39-22-28(43)38-21-24-17-13-12-14-18-24/h12-14,17-18,25-27,29-30H,6-11,15-16,19-23H2,1-5H3,(H,38,43)(H,39,46)(H,40,45)(H,41,48)/t25-,26-,27-,29-,30-/m0/s1 |
| InChIKey | BSLAPVCQDHYQLL-HXSXYBSHSA-N |
| XLogP | 3.76 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|