C28H46N4O6 — CID 25190642
tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate (PubChem CID 25190642) has the molecular formula C28H46N4O6 and a molecular weight of 534.70 g/mol. Its IUPAC name is tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
|---|---|
| PubChem CID | 25190642 |
| Molecular Formula | C28H46N4O6 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCCCCCC[C@@H](C(=O)C(N)=O)NC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C28H46N4O6/c1-27(2,3)38-26(37)31-19-15-13-11-9-7-6-8-10-12-14-18(22(33)23(29)34)30-24(35)21-20-17(28(20,4)5)16-32(21)25(19)36/h17-21H,6-16H2,1-5H3,(H2,29,34)(H,30,35)(H,31,37)/t17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | GFWILMZRBXKJAP-SXYSDOLCSA-N |
| XLogP | 2.82 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|