C28H47N5O5 — CID 25190643
2-[(3S,14S,17S,18R,20S)-3-(tert-butylcarbamoylamino)-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-14-yl]-2-oxoacetamide (PubChem CID 25190643) has the molecular formula C28H47N5O5 and a molecular weight of 533.71 g/mol. Its IUPAC name is 2-[(3S,14S,17S,18R,20S)-3-(tert-butylcarbamoylamino)-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-14-yl]-2-oxoacetamide.
| Compound Name | 2-[(3S,14S,17S,18R,20S)-3-(tert-butylcarbamoylamino)-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-14-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 25190643 |
| Molecular Formula | C28H47N5O5 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.36 |
| IUPAC Name | 2-[(3S,14S,17S,18R,20S)-3-(tert-butylcarbamoylamino)-19,19-dimethyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-14-yl]-2-oxoacetamide |
| SMILES | CC(C)(C)NC(=O)N[C@H]1CCCCCCCCCC[C@@H](C(=O)C(N)=O)NC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C28H47N5O5/c1-27(2,3)32-26(38)31-19-15-13-11-9-7-6-8-10-12-14-18(22(34)23(29)35)30-24(36)21-20-17(28(20,4)5)16-33(21)25(19)37/h17-21H,6-16H2,1-5H3,(H2,29,35)(H,30,36)(H2,31,32,38)/t17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | NHEVGEJNGWFCBL-SXYSDOLCSA-N |
| XLogP | 2.39 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|