C34H57N5O7 — CID 25190645
tert-butyl (2S)-2-[[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamoylamino]-3,3-dimethylbutanoate (PubChem CID 25190645) has the molecular formula C34H57N5O7 and a molecular weight of 647.86 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamoylamino]-3,3-dimethylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamoylamino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 25190645 |
| Molecular Formula | C34H57N5O7 |
| Molecular Weight | 647.86 g/mol |
| Exact Mass | 647.43 |
| IUPAC Name | tert-butyl (2S)-2-[[(3S,14S,17S,18R,20S)-19,19-dimethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamoylamino]-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](NC(=O)N[C@H]1CCCCCCCCCC[C@@H](C(=O)C(N)=O)NC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C)C(C)(C)C |
| InChI | InChI=1S/C34H57N5O7/c1-32(2,3)26(30(44)46-33(4,5)6)38-31(45)37-22-18-16-14-12-10-9-11-13-15-17-21(25(40)27(35)41)36-28(42)24-23-20(34(23,7)8)19-39(24)29(22)43/h20-24,26H,9-19H2,1-8H3,(H2,35,41)(H,36,42)(H2,37,38,45)/t20-,21-,22-,23-,24-,26+/m0/s1 |
| InChIKey | XXGJUQCAAYVQPH-LQCCLCBXSA-N |
| XLogP | 3.35 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|