C27H44N4O6 — CID 25190649
tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-13-oxamoyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate (PubChem CID 25190649) has the molecular formula C27H44N4O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-13-oxamoyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-13-oxamoyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
|---|---|
| PubChem CID | 25190649 |
| Molecular Formula | C27H44N4O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-13-oxamoyl-2,15-dioxo-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCCCCC[C@@H](C(=O)C(N)=O)NC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C27H44N4O6/c1-26(2,3)37-25(36)30-18-14-12-10-8-6-7-9-11-13-17(21(32)22(28)33)29-23(34)20-19-16(27(19,4)5)15-31(20)24(18)35/h16-20H,6-15H2,1-5H3,(H2,28,33)(H,29,34)(H,30,36)/t16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | APKSIFMITNSEJK-HVTWWXFQSA-N |
| XLogP | 2.43 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|