C29H45N5O8 — CID 25190688
tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-2,8,16-trioxo-14-[2-oxo-2-(prop-2-enylamino)acetyl]-7-oxa-1,9,15-triazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate (PubChem CID 25190688) has the molecular formula C29H45N5O8 and a molecular weight of 591.71 g/mol. Its IUPAC name is tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-2,8,16-trioxo-14-[2-oxo-2-(prop-2-enylamino)acetyl]-7-oxa-1,9,15-triazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-2,8,16-trioxo-14-[2-oxo-2-(prop-2-enylamino)acetyl]-7-oxa-1,9,15-triazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
|---|---|
| PubChem CID | 25190688 |
| Molecular Formula | C29H45N5O8 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | tert-butyl N-[(3S,14S,17S,18R,20S)-19,19-dimethyl-2,8,16-trioxo-14-[2-oxo-2-(prop-2-enylamino)acetyl]-7-oxa-1,9,15-triazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
| SMILES | C=CCNC(=O)C(=O)[C@@H]1CCCCNC(=O)OCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C29H45N5O8/c1-7-13-30-24(37)22(35)18-11-8-9-14-31-26(39)41-15-10-12-19(33-27(40)42-28(2,3)4)25(38)34-16-17-20(29(17,5)6)21(34)23(36)32-18/h7,17-21H,1,8-16H2,2-6H3,(H,30,37)(H,31,39)(H,32,36)(H,33,40)/t17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | WIPUVGVYMJVDAP-SXYSDOLCSA-N |
| XLogP | 1.41 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|