C30H46N4O7 — CID 25190689
tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate (PubChem CID 25190689) has the molecular formula C30H46N4O7 and a molecular weight of 574.72 g/mol. Its IUPAC name is tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
|---|---|
| PubChem CID | 25190689 |
| Molecular Formula | C30H46N4O7 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
| SMILES | C=CCNC(=O)C(=O)[C@@H]1CCCCCCC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C30H46N4O7/c1-7-16-31-26(38)24(36)20-13-11-9-8-10-12-18(35)14-15-21(33-28(40)41-29(2,3)4)27(39)34-17-19-22(30(19,5)6)23(34)25(37)32-20/h7,19-23H,1,8-17H2,2-6H3,(H,31,38)(H,32,37)(H,33,40)/t19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | BJZFUDOPEUIYJS-VUBDRERZSA-N |
| XLogP | 2.42 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|