C30H50N4O6 — CID 25190690
tert-butyl N-[(3S,14S,17S,18R,20S)-4,4,19,19-tetramethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate (PubChem CID 25190690) has the molecular formula C30H50N4O6 and a molecular weight of 562.75 g/mol. Its IUPAC name is tert-butyl N-[(3S,14S,17S,18R,20S)-4,4,19,19-tetramethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,14S,17S,18R,20S)-4,4,19,19-tetramethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
|---|---|
| PubChem CID | 25190690 |
| Molecular Formula | C30H50N4O6 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.37 |
| IUPAC Name | tert-butyl N-[(3S,14S,17S,18R,20S)-4,4,19,19-tetramethyl-14-oxamoyl-2,16-dioxo-1,15-diazatricyclo[15.4.0.018,20]henicosan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N[C@H](C(=O)C(N)=O)CCCCCCCCCC1(C)C)C3(C)C |
| InChI | InChI=1S/C30H50N4O6/c1-28(2,3)40-27(39)33-23-26(38)34-17-18-20(30(18,6)7)21(34)25(37)32-19(22(35)24(31)36)15-13-11-9-8-10-12-14-16-29(23,4)5/h18-21,23H,8-17H2,1-7H3,(H2,31,36)(H,32,37)(H,33,39)/t18-,19-,20-,21-,23+/m0/s1 |
| InChIKey | BQHVVVJXTSIIEW-DDTUGOMQSA-N |
| XLogP | 3.45 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|