C14H18N4O — CID 25190722
2-(azepan-4-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 25190722) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(azepan-4-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-(azepan-4-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 25190722 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-(azepan-4-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2[nH]c(C3CCCNCC3)nc12 |
| InChI | InChI=1S/C14H18N4O/c15-13(19)10-4-1-5-11-12(10)18-14(17-11)9-3-2-7-16-8-6-9/h1,4-5,9,16H,2-3,6-8H2,(H2,15,19)(H,17,18) |
| InChIKey | GHOYFPNFUYWZAZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |