About 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine
9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine (PubChem CID 25190877) has the molecular formula C22H18Cl3N5
and a molecular weight of 458.78 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine.
Molecular Properties
| Compound Name | 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine |
| PubChem CID | 25190877 |
| Molecular Formula | C22H18Cl3N5 |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine |
| SMILES | Clc1ccc(-n2c(-c3ccc(Cl)cc3Cl)nc3c(N4CCCCC4)ncnc32)cc1 |
| InChI | InChI=1S/C22H18Cl3N5/c23-14-4-7-16(8-5-14)30-20(17-9-6-15(24)12-18(17)25)28-19-21(26-13-27-22(19)30)29-10-2-1-3-11-29/h4-9,12-13H,1-3,10-11H2 |
| InChIKey | JQNLVQKIAYWCJT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine?
The IUPAC name of 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine (CID 25190877) is 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine.
What is the SMILES notation for 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine?
The canonical SMILES for 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine is Clc1ccc(-n2c(-c3ccc(Cl)cc3Cl)nc3c(N4CCCCC4)ncnc32)cc1.
What is the InChIKey of 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine?
The InChIKey is JQNLVQKIAYWCJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl3N5/c23-14-4-7-16(8-5-14)30-20(17-9-6-15(24)12-18(17)25)28-19-21(26-13-27-22(19)30)29-10-2-1-3-11-29/h4-9,12-13H,1-3,10-11H2.
What are the key properties of 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine?
9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine has a molecular weight of 458.78 g/mol, XLogP of 6.43, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)-6-piperidin-1-ylpurine is sourced from PubChem (CID 25190877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).