C20H21N5O2 — CID 25190894
2-(2-aminopyrimidin-4-yl)-7-(2-phenylmethoxyethyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 25190894) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-4-yl)-7-(2-phenylmethoxyethyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-(2-aminopyrimidin-4-yl)-7-(2-phenylmethoxyethyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 25190894 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-(2-aminopyrimidin-4-yl)-7-(2-phenylmethoxyethyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | Nc1nccc(-c2cc3c([nH]2)C(CCOCc2ccccc2)CNC3=O)n1 |
| InChI | InChI=1S/C20H21N5O2/c21-20-22-8-6-16(25-20)17-10-15-18(24-17)14(11-23-19(15)26)7-9-27-12-13-4-2-1-3-5-13/h1-6,8,10,14,24H,7,9,11-12H2,(H,23,26)(H2,21,22,25) |
| InChIKey | QUGLBFISIMJWOG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|