C21H23N5O2 — CID 25190895
2-(2-aminopyrimidin-4-yl)-7-(3-phenylmethoxypropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 25190895) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-4-yl)-7-(3-phenylmethoxypropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-(2-aminopyrimidin-4-yl)-7-(3-phenylmethoxypropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 25190895 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-(2-aminopyrimidin-4-yl)-7-(3-phenylmethoxypropyl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | Nc1nccc(-c2cc3c([nH]2)C(CCCOCc2ccccc2)CNC3=O)n1 |
| InChI | InChI=1S/C21H23N5O2/c22-21-23-9-8-17(26-21)18-11-16-19(25-18)15(12-24-20(16)27)7-4-10-28-13-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,15,25H,4,7,10,12-13H2,(H,24,27)(H2,22,23,26) |
| InChIKey | JCIGSRTZMOSPLT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|