C13H12N4S — CID 25190902
7-methyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaen-12-amine (PubChem CID 25190902) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 7-methyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaen-12-amine.
| Compound Name | 7-methyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaen-12-amine |
|---|---|
| PubChem CID | 25190902 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 7-methyl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11(16),12,14-hexaen-12-amine |
| SMILES | Cc1nc2sc3c(N)ncnc3c2c2c1CCC2 |
| InChI | InChI=1S/C13H12N4S/c1-6-7-3-2-4-8(7)9-10-11(18-13(9)17-6)12(14)16-5-15-10/h5H,2-4H2,1H3,(H2,14,15,16) |
| InChIKey | YMPQZSPOMNODPH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |