C13H9F3N4S — CID 25190905
11-cyclopropyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 25190905) has the molecular formula C13H9F3N4S and a molecular weight of 310.30 g/mol. Its IUPAC name is 11-cyclopropyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 11-cyclopropyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 25190905 |
| Molecular Formula | C13H9F3N4S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 11-cyclopropyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1sc1nc(C3CC3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C13H9F3N4S/c14-13(15,16)6-3-7(5-1-2-5)20-12-8(6)9-10(21-12)11(17)19-4-18-9/h3-5H,1-2H2,(H2,17,18,19) |
| InChIKey | CRXPAIPXKPBRLN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |