C13H12N4O2S — CID 25190907
ethyl 6-amino-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylate (PubChem CID 25190907) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is ethyl 6-amino-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylate.
| Compound Name | ethyl 6-amino-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 25190907 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | ethyl 6-amino-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylate |
| SMILES | CCOC(=O)c1cc2c(nc1C)sc1c(N)ncnc12 |
| InChI | InChI=1S/C13H12N4O2S/c1-3-19-13(18)7-4-8-9-10(11(14)16-5-15-9)20-12(8)17-6(7)2/h4-5H,3H2,1-2H3,(H2,14,15,16) |
| InChIKey | ORMANVRRAHMNDI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |