About 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one
8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 25190929) has the molecular formula C16H10N2O3
and a molecular weight of 278.27 g/mol. Its IUPAC name is 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
Molecular Properties
| Compound Name | 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| PubChem CID | 25190929 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2c(c3ccccc13)Cc1ccc([N+](=O)[O-])cc1-2 |
| InChI | InChI=1S/C16H10N2O3/c19-16-12-4-2-1-3-11(12)14-7-9-5-6-10(18(20)21)8-13(9)15(14)17-16/h1-6,8H,7H2,(H,17,19) |
| InChIKey | SWBDUXDIPMGDNO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
The IUPAC name of 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (CID 25190929) is 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
What is the SMILES notation for 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
The canonical SMILES for 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one is O=c1[nH]c2c(c3ccccc13)Cc1ccc([N+](=O)[O-])cc1-2.
What is the InChIKey of 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
The InChIKey is SWBDUXDIPMGDNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O3/c19-16-12-4-2-1-3-11(12)14-7-9-5-6-10(18(20)21)8-13(9)15(14)17-16/h1-6,8H,7H2,(H,17,19).
What are the key properties of 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one?
8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one has a molecular weight of 278.27 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-6,11-dihydroindeno[1,2-c]isoquinolin-5-one is sourced from PubChem (CID 25190929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).