C19H19NO2 — CID 25190934
(1S)-1,2-dimethyl-9,11-dioxa-2-azapentacyclo[14.3.1.05,19.08,18.012,17]icosa-5(19),6,8(18),12,14,16-hexaene (PubChem CID 25190934) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (1S)-1,2-dimethyl-9,11-dioxa-2-azapentacyclo[14.3.1.05,19.08,18.012,17]icosa-5(19),6,8(18),12,14,16-hexaene.
| Compound Name | (1S)-1,2-dimethyl-9,11-dioxa-2-azapentacyclo[14.3.1.05,19.08,18.012,17]icosa-5(19),6,8(18),12,14,16-hexaene |
|---|---|
| PubChem CID | 25190934 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (1S)-1,2-dimethyl-9,11-dioxa-2-azapentacyclo[14.3.1.05,19.08,18.012,17]icosa-5(19),6,8(18),12,14,16-hexaene |
| SMILES | CN1CCc2ccc3c4c2[C@]1(C)Cc1cccc(c1-4)OCO3 |
| InChI | InChI=1S/C19H19NO2/c1-19-10-13-4-3-5-14-16(13)17-15(22-11-21-14)7-6-12(18(17)19)8-9-20(19)2/h3-7H,8-11H2,1-2H3/t19-/m0/s1 |
| InChIKey | IIYPQFFWVOUFAF-IBGZPJMESA-N |
| XLogP | 3.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |