C24H39NO4 — CID 25190949
(2S,3S)-3-methyl-2-[8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoylamino]pentanoic acid (PubChem CID 25190949) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoylamino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 25190949 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | (2S,3S)-3-methyl-2-[8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoylamino]pentanoic acid |
| SMILES | CC/C=C\C[C@@H]1C(=O)C=C[C@@H]1CCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C24H39NO4/c1-4-6-10-14-20-19(16-17-21(20)26)13-11-8-7-9-12-15-22(27)25-23(24(28)29)18(3)5-2/h6,10,16-20,23H,4-5,7-9,11-15H2,1-3H3,(H,25,27)(H,28,29)/b10-6-/t18-,19-,20-,23-/m0/s1 |
| InChIKey | PTOYKLKRHSDZSH-KWYIECQPSA-N |
| XLogP | 5.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|