C20H18O4 — CID 25191039
3,6-bis(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol (PubChem CID 25191039) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3,6-bis(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol.
| Compound Name | 3,6-bis(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 25191039 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3,6-bis(4-hydroxyphenyl)-4,5-dimethylbenzene-1,2-diol |
| SMILES | Cc1c(C)c(-c2ccc(O)cc2)c(O)c(O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C20H18O4/c1-11-12(2)18(14-5-9-16(22)10-6-14)20(24)19(23)17(11)13-3-7-15(21)8-4-13/h3-10,21-24H,1-2H3 |
| InChIKey | RUTNALOYVNJHSP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|