About (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one
(6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one (PubChem CID 25191168) has the molecular formula C17H20OS
and a molecular weight of 272.41 g/mol. Its IUPAC name is (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one |
| PubChem CID | 25191168 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one |
| SMILES | C=CC[C@@]1(C)CCC(Sc2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C17H20OS/c1-4-11-17(3)12-10-15(13(2)16(17)18)19-14-8-6-5-7-9-14/h4-9H,1,10-12H2,2-3H3/t17-/m0/s1 |
| InChIKey | VAENJECXQHHMCK-KRWDZBQOSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one?
The IUPAC name of (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one (CID 25191168) is (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one.
What is the SMILES notation for (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one?
The canonical SMILES for (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one is C=CC[C@@]1(C)CCC(Sc2ccccc2)=C(C)C1=O.
What is the InChIKey of (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one?
The InChIKey is VAENJECXQHHMCK-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H20OS/c1-4-11-17(3)12-10-15(13(2)16(17)18)19-14-8-6-5-7-9-14/h4-9H,1,10-12H2,2-3H3/t17-/m0/s1.
What are the key properties of (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one?
(6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one has a molecular weight of 272.41 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,6-dimethyl-3-phenylsulfanyl-6-prop-2-enylcyclohex-2-en-1-one is sourced from PubChem (CID 25191168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).