C21H21NO5 — CID 25191313
methyl (2S,3R)-4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-phenylmethoxybutanoate (PubChem CID 25191313) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl (2S,3R)-4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-phenylmethoxybutanoate.
| Compound Name | methyl (2S,3R)-4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 25191313 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl (2S,3R)-4-(1,3-dioxoisoindol-2-yl)-2-methyl-3-phenylmethoxybutanoate |
| SMILES | COC(=O)[C@@H](C)[C@H](CN1C(=O)c2ccccc2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21NO5/c1-14(21(25)26-2)18(27-13-15-8-4-3-5-9-15)12-22-19(23)16-10-6-7-11-17(16)20(22)24/h3-11,14,18H,12-13H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | HFILIJQGHZDNQV-KSSFIOAISA-N |
| XLogP | 2.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|