C30H29F2NO9 — CID 25191487
methyl 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate (PubChem CID 25191487) has the molecular formula C30H29F2NO9 and a molecular weight of 585.56 g/mol. Its IUPAC name is methyl 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate.
| Compound Name | methyl 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate |
|---|---|
| PubChem CID | 25191487 |
| Molecular Formula | C30H29F2NO9 |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | methyl 2-[18-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-2,5,8,11-tetraoxa-14-azabicyclo[13.4.0]nonadeca-1(15),16,18-trien-14-yl]acetate |
| SMILES | COC(=O)CN1CCOCCOCCOCCOc2cc(-c3c4cc(F)c(=O)cc-4oc4cc(O)c(F)cc34)ccc21 |
| InChI | InChI=1S/C30H29F2NO9/c1-37-29(36)17-33-4-5-38-6-7-39-8-9-40-10-11-41-28-12-18(2-3-23(28)33)30-19-13-21(31)24(34)15-26(19)42-27-16-25(35)22(32)14-20(27)30/h2-3,12-16,34H,4-11,17H2,1H3 |
| InChIKey | READSMMMYWDJJS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|