About 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine
1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine (PubChem CID 25191494) has the molecular formula C17H16F2N4O2S
and a molecular weight of 378.40 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine |
| PubChem CID | 25191494 |
| Molecular Formula | C17H16F2N4O2S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine |
| SMILES | O=S(=O)(c1cc(F)ccc1F)n1cc(N2CCNCC2)c2ncccc21 |
| InChI | InChI=1S/C17H16F2N4O2S/c18-12-3-4-13(19)16(10-12)26(24,25)23-11-15(22-8-6-20-7-9-22)17-14(23)2-1-5-21-17/h1-5,10-11,20H,6-9H2 |
| InChIKey | VMFDTIXBWADLDQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine?
The IUPAC name of 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine (CID 25191494) is 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine.
What is the SMILES notation for 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine?
The canonical SMILES for 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine is O=S(=O)(c1cc(F)ccc1F)n1cc(N2CCNCC2)c2ncccc21.
What is the InChIKey of 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine?
The InChIKey is VMFDTIXBWADLDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N4O2S/c18-12-3-4-13(19)16(10-12)26(24,25)23-11-15(22-8-6-20-7-9-22)17-14(23)2-1-5-21-17/h1-5,10-11,20H,6-9H2.
What are the key properties of 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine?
1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine has a molecular weight of 378.40 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-difluorophenyl)sulfonyl-3-piperazin-1-ylpyrrolo[3,2-b]pyridine is sourced from PubChem (CID 25191494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).