C23H19ClN2O2 — CID 25191664
(5R)-2-(4-chlorophenyl)-5-ethyl-4,5-diphenyl-1,3,4-oxadiazin-6-one (PubChem CID 25191664) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is (5R)-2-(4-chlorophenyl)-5-ethyl-4,5-diphenyl-1,3,4-oxadiazin-6-one.
| Compound Name | (5R)-2-(4-chlorophenyl)-5-ethyl-4,5-diphenyl-1,3,4-oxadiazin-6-one |
|---|---|
| PubChem CID | 25191664 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (5R)-2-(4-chlorophenyl)-5-ethyl-4,5-diphenyl-1,3,4-oxadiazin-6-one |
| SMILES | CC[C@@]1(c2ccccc2)C(=O)OC(c2ccc(Cl)cc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C23H19ClN2O2/c1-2-23(18-9-5-3-6-10-18)22(27)28-21(17-13-15-19(24)16-14-17)25-26(23)20-11-7-4-8-12-20/h3-16H,2H2,1H3/t23-/m1/s1 |
| InChIKey | OFXHOSVVSOAFPG-HSZRJFAPSA-N |
| XLogP | 5.37 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |