C34H35NO7 — CID 25191684
(2S,3S,4S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 25191684) has the molecular formula C34H35NO7 and a molecular weight of 569.65 g/mol. Its IUPAC name is (2S,3S,4S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S,3S,4S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 25191684 |
| Molecular Formula | C34H35NO7 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | (2S,3S,4S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(N[C@H](C(=O)O)[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H35NO7/c36-33(37)31(35-34(38)42-24-29-19-11-4-12-20-29)32(41-23-28-17-9-3-10-18-28)30(40-22-27-15-7-2-8-16-27)25-39-21-26-13-5-1-6-14-26/h1-20,30-32H,21-25H2,(H,35,38)(H,36,37)/t30-,31-,32+/m0/s1 |
| InChIKey | IZSUTBHIQLBXKD-OWHBQTKESA-N |
| XLogP | 5.75 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |