C8H22Cl2N2 — CID 25191804
(3S,4S)-2,5-dimethylhexane-3,4-diamine;dihydrochloride (PubChem CID 25191804) has the molecular formula C8H22Cl2N2 and a molecular weight of 217.18 g/mol. Its IUPAC name is (3S,4S)-2,5-dimethylhexane-3,4-diamine;dihydrochloride.
| Compound Name | (3S,4S)-2,5-dimethylhexane-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 25191804 |
| Molecular Formula | C8H22Cl2N2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3S,4S)-2,5-dimethylhexane-3,4-diamine;dihydrochloride |
| SMILES | CC(C)[C@H](N)[C@@H](N)C(C)C.Cl.Cl |
| InChI | InChI=1S/C8H20N2.2ClH/c1-5(2)7(9)8(10)6(3)4;;/h5-8H,9-10H2,1-4H3;2*1H/t7-,8-;;/m0../s1 |
| InChIKey | DBBIHMCJXWNFHF-FOMWZSOGSA-N |
| XLogP | 1.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |