About (3S,4S)-2,5-dimethylhexane-3,4-diamine
(3S,4S)-2,5-dimethylhexane-3,4-diamine (PubChem CID 25191805) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is (3S,4S)-2,5-dimethylhexane-3,4-diamine.
Molecular Properties
| Compound Name | (3S,4S)-2,5-dimethylhexane-3,4-diamine |
| PubChem CID | 25191805 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | (3S,4S)-2,5-dimethylhexane-3,4-diamine |
| SMILES | CC(C)[C@H](N)[C@@H](N)C(C)C |
| InChI | InChI=1S/C8H20N2/c1-5(2)7(9)8(10)6(3)4/h5-8H,9-10H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | KQDYUNYMUMMKOL-YUMQZZPRSA-N |
| XLogP | 0.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-2,5-dimethylhexane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-2,5-dimethylhexane-3,4-diamine?
The IUPAC name of (3S,4S)-2,5-dimethylhexane-3,4-diamine (CID 25191805) is (3S,4S)-2,5-dimethylhexane-3,4-diamine.
What is the SMILES notation for (3S,4S)-2,5-dimethylhexane-3,4-diamine?
The canonical SMILES for (3S,4S)-2,5-dimethylhexane-3,4-diamine is CC(C)[C@H](N)[C@@H](N)C(C)C.
What is the InChIKey of (3S,4S)-2,5-dimethylhexane-3,4-diamine?
The InChIKey is KQDYUNYMUMMKOL-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H20N2/c1-5(2)7(9)8(10)6(3)4/h5-8H,9-10H2,1-4H3/t7-,8-/m0/s1.
What are the key properties of (3S,4S)-2,5-dimethylhexane-3,4-diamine?
(3S,4S)-2,5-dimethylhexane-3,4-diamine has a molecular weight of 144.26 g/mol, XLogP of 0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-2,5-dimethylhexane-3,4-diamine is sourced from PubChem (CID 25191805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).