C35H36F2N2O6 — CID 25191878
4-[3-[6-[3,5-bis(2-fluoro-4-pyridinyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 25191878) has the molecular formula C35H36F2N2O6 and a molecular weight of 618.68 g/mol. Its IUPAC name is 4-[3-[6-[3,5-bis(2-fluoro-4-pyridinyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3,5-bis(2-fluoro-4-pyridinyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 25191878 |
| Molecular Formula | C35H36F2N2O6 |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 4-[3-[6-[3,5-bis(2-fluoro-4-pyridinyl)phenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccnc(F)c3)cc(-c3ccnc(F)c3)c2)c1CCC(=O)O |
| InChI | InChI=1S/C35H36F2N2O6/c36-32-22-25(13-15-38-32)27-19-28(26-14-16-39-33(37)23-26)21-29(20-27)44-17-4-2-1-3-7-24-8-5-9-31(30(24)11-12-35(42)43)45-18-6-10-34(40)41/h5,8-9,13-16,19-23H,1-4,6-7,10-12,17-18H2,(H,40,41)(H,42,43) |
| InChIKey | CGFVBKOEIDWPLK-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|