C25H22ClNO3 — CID 25191943
methyl (2S,3S,4R,5R)-4-(4-chlorobenzoyl)-3,5-diphenylpyrrolidine-2-carboxylate (PubChem CID 25191943) has the molecular formula C25H22ClNO3 and a molecular weight of 419.91 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R)-4-(4-chlorobenzoyl)-3,5-diphenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R)-4-(4-chlorobenzoyl)-3,5-diphenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 25191943 |
| Molecular Formula | C25H22ClNO3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl (2S,3S,4R,5R)-4-(4-chlorobenzoyl)-3,5-diphenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccccc2)[C@H](C(=O)c2ccc(Cl)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H22ClNO3/c1-30-25(29)23-20(16-8-4-2-5-9-16)21(22(27-23)17-10-6-3-7-11-17)24(28)18-12-14-19(26)15-13-18/h2-15,20-23,27H,1H3/t20-,21-,22+,23+/m1/s1 |
| InChIKey | ZBUGFULVFNDNJY-LUKWVAJMSA-N |
| XLogP | 4.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |