C24H34N2O2S6 — CID 25191970
2-[1-[2-(dimethylamino)ethyl]-4,10-dimethoxy-2,8-bis(methylsulfanyl)benzo[c][1,2,5,6]benzotetrathiocin-7-yl]-N,N-dimethylethanamine (PubChem CID 25191970) has the molecular formula C24H34N2O2S6 and a molecular weight of 574.95 g/mol. Its IUPAC name is 2-[1-[2-(dimethylamino)ethyl]-4,10-dimethoxy-2,8-bis(methylsulfanyl)benzo[c][1,2,5,6]benzotetrathiocin-7-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[1-[2-(dimethylamino)ethyl]-4,10-dimethoxy-2,8-bis(methylsulfanyl)benzo[c][1,2,5,6]benzotetrathiocin-7-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 25191970 |
| Molecular Formula | C24H34N2O2S6 |
| Molecular Weight | 574.95 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 2-[1-[2-(dimethylamino)ethyl]-4,10-dimethoxy-2,8-bis(methylsulfanyl)benzo[c][1,2,5,6]benzotetrathiocin-7-yl]-N,N-dimethylethanamine |
| SMILES | COc1cc(SC)c(CCN(C)C)c2c1SSc1c(CCN(C)C)c(SC)cc(OC)c1SS2 |
| InChI | InChI=1S/C24H34N2O2S6/c1-25(2)11-9-15-19(29-7)13-17(27-5)23-21(15)31-34-24-18(28-6)14-20(30-8)16(10-12-26(3)4)22(24)32-33-23/h13-14H,9-12H2,1-8H3 |
| InChIKey | VUGHCJHPVTWUAS-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.95 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|