C37H40O6 — CID 25192021
4-[2-(2-carboxyethyl)-3-[6-(3,5-diphenylphenoxy)hexyl]phenoxy]butanoic acid (PubChem CID 25192021) has the molecular formula C37H40O6 and a molecular weight of 580.72 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-(3,5-diphenylphenoxy)hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-(3,5-diphenylphenoxy)hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 25192021 |
| Molecular Formula | C37H40O6 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-(3,5-diphenylphenoxy)hexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1CCC(=O)O |
| InChI | InChI=1S/C37H40O6/c38-36(39)20-12-24-43-35-19-11-18-30(34(35)21-22-37(40)41)17-5-1-2-10-23-42-33-26-31(28-13-6-3-7-14-28)25-32(27-33)29-15-8-4-9-16-29/h3-4,6-9,11,13-16,18-19,25-27H,1-2,5,10,12,17,20-24H2,(H,38,39)(H,40,41) |
| InChIKey | SMNCEXHPBATBIT-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|