C36H38N2O8 — CID 25192176
4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-pyrimidin-5-ylphenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid (PubChem CID 25192176) has the molecular formula C36H38N2O8 and a molecular weight of 626.71 g/mol. Its IUPAC name is 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-pyrimidin-5-ylphenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-pyrimidin-5-ylphenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 25192176 |
| Molecular Formula | C36H38N2O8 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 4-[3-[6-[3-(1,3-benzodioxol-5-yl)-5-pyrimidin-5-ylphenoxy]hexyl]-2-(2-carboxyethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3cncnc3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O |
| InChI | InChI=1S/C36H38N2O8/c39-35(40)10-6-16-44-32-9-5-8-25(31(32)12-14-36(41)42)7-3-1-2-4-15-43-30-18-27(17-28(19-30)29-21-37-23-38-22-29)26-11-13-33-34(20-26)46-24-45-33/h5,8-9,11,13,17-23H,1-4,6-7,10,12,14-16,24H2,(H,39,40)(H,41,42) |
| InChIKey | FRDONAYSGBGPJH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|