C30H33F3N2O — CID 25192200
2-(2,6-diethylphenyl)-4-methoxy-5-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6,7,8-tetrahydroquinoline (PubChem CID 25192200) has the molecular formula C30H33F3N2O and a molecular weight of 494.60 g/mol. Its IUPAC name is 2-(2,6-diethylphenyl)-4-methoxy-5-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-(2,6-diethylphenyl)-4-methoxy-5-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 25192200 |
| Molecular Formula | C30H33F3N2O |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-(2,6-diethylphenyl)-4-methoxy-5-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6,7,8-tetrahydroquinoline |
| SMILES | CCc1cccc(CC)c1-c1cc(OC)c2c(n1)CCCC2N1CCc2cccc(C(F)(F)F)c2C1 |
| InChI | InChI=1S/C30H33F3N2O/c1-4-19-9-6-10-20(5-2)28(19)25-17-27(36-3)29-24(34-25)13-8-14-26(29)35-16-15-21-11-7-12-23(22(21)18-35)30(31,32)33/h6-7,9-12,17,26H,4-5,8,13-16,18H2,1-3H3 |
| InChIKey | WHPOPVNAZREUII-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |