C32H36N2O2 — CID 25192491
2-(2,6-diethylphenyl)-4-methoxy-N-(4-methoxynaphthalen-1-yl)-N-methyl-5,6,7,8-tetrahydroquinolin-5-amine (PubChem CID 25192491) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is 2-(2,6-diethylphenyl)-4-methoxy-N-(4-methoxynaphthalen-1-yl)-N-methyl-5,6,7,8-tetrahydroquinolin-5-amine.
| Compound Name | 2-(2,6-diethylphenyl)-4-methoxy-N-(4-methoxynaphthalen-1-yl)-N-methyl-5,6,7,8-tetrahydroquinolin-5-amine |
|---|---|
| PubChem CID | 25192491 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 2-(2,6-diethylphenyl)-4-methoxy-N-(4-methoxynaphthalen-1-yl)-N-methyl-5,6,7,8-tetrahydroquinolin-5-amine |
| SMILES | CCc1cccc(CC)c1-c1cc(OC)c2c(n1)CCCC2N(C)c1ccc(OC)c2ccccc12 |
| InChI | InChI=1S/C32H36N2O2/c1-6-21-12-10-13-22(7-2)31(21)26-20-30(36-5)32-25(33-26)16-11-17-28(32)34(3)27-18-19-29(35-4)24-15-9-8-14-23(24)27/h8-10,12-15,18-20,28H,6-7,11,16-17H2,1-5H3 |
| InChIKey | CIGDMCHLABXMIY-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|