C20H19N5O3S — CID 25192612
6-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonyl-1H-quinolin-2-one (PubChem CID 25192612) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 6-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonyl-1H-quinolin-2-one.
| Compound Name | 6-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 25192612 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 6-(3-piperazin-1-ylpyrrolo[3,2-b]pyridin-1-yl)sulfonyl-1H-quinolin-2-one |
| SMILES | O=c1ccc2cc(S(=O)(=O)n3cc(N4CCNCC4)c4ncccc43)ccc2[nH]1 |
| InChI | InChI=1S/C20H19N5O3S/c26-19-6-3-14-12-15(4-5-16(14)23-19)29(27,28)25-13-18(24-10-8-21-9-11-24)20-17(25)2-1-7-22-20/h1-7,12-13,21H,8-11H2,(H,23,26) |
| InChIKey | PNSYXTUQGQGASV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |